C7H14IN — CID 177325469
(2R)-4-iodo-1,2-dimethylpiperidine (PubChem CID 177325469) has the molecular formula C7H14IN and a molecular weight of 239.10 g/mol. Its IUPAC name is (2R)-4-iodo-1,2-dimethylpiperidine.
| Compound Name | (2R)-4-iodo-1,2-dimethylpiperidine |
|---|---|
| PubChem CID | 177325469 |
| Molecular Formula | C7H14IN |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | (2R)-4-iodo-1,2-dimethylpiperidine |
| SMILES | C[C@@H]1CC(I)CCN1C |
| InChI | InChI=1S/C7H14IN/c1-6-5-7(8)3-4-9(6)2/h6-7H,3-5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | TYAKPATXGZHZAJ-ULUSZKPHSA-N |
| XLogP | 1.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|