C6H11I2N — CID 170289869
1,4-diiodo-2-methylpiperidine (PubChem CID 170289869) has the molecular formula C6H11I2N and a molecular weight of 350.97 g/mol. Its IUPAC name is 1,4-diiodo-2-methylpiperidine.
| Compound Name | 1,4-diiodo-2-methylpiperidine |
|---|---|
| PubChem CID | 170289869 |
| Molecular Formula | C6H11I2N |
| Molecular Weight | 350.97 g/mol |
| Exact Mass | 350.90 |
| IUPAC Name | 1,4-diiodo-2-methylpiperidine |
| SMILES | CC1CC(I)CCN1I |
| InChI | InChI=1S/C6H11I2N/c1-5-4-6(7)2-3-9(5)8/h5-6H,2-4H2,1H3 |
| InChIKey | CFUWZVXCWLWVLX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.97 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|