C6H12I2N2 — CID 160927554
(2S,6R)-1,4-diiodo-2,6-dimethylpiperazine (PubChem CID 160927554) has the molecular formula C6H12I2N2 and a molecular weight of 365.98 g/mol. Its IUPAC name is (2S,6R)-1,4-diiodo-2,6-dimethylpiperazine.
| Compound Name | (2S,6R)-1,4-diiodo-2,6-dimethylpiperazine |
|---|---|
| PubChem CID | 160927554 |
| Molecular Formula | C6H12I2N2 |
| Molecular Weight | 365.98 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | (2S,6R)-1,4-diiodo-2,6-dimethylpiperazine |
| SMILES | C[C@@H]1CN(I)C[C@H](C)N1I |
| InChI | InChI=1S/C6H12I2N2/c1-5-3-9(7)4-6(2)10(5)8/h5-6H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | SSVMHFNUARHHGJ-OLQVQODUSA-N |
| XLogP | 2.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.98 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|