C12H24IN3 — CID 167014766
4-(1-iodopiperidin-4-yl)-1,2,6-trimethylpiperazine (PubChem CID 167014766) has the molecular formula C12H24IN3 and a molecular weight of 337.25 g/mol. Its IUPAC name is 4-(1-iodopiperidin-4-yl)-1,2,6-trimethylpiperazine.
| Compound Name | 4-(1-iodopiperidin-4-yl)-1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 167014766 |
| Molecular Formula | C12H24IN3 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 4-(1-iodopiperidin-4-yl)-1,2,6-trimethylpiperazine |
| SMILES | CC1CN(C2CCN(I)CC2)CC(C)N1C |
| InChI | InChI=1S/C12H24IN3/c1-10-8-15(9-11(2)14(10)3)12-4-6-16(13)7-5-12/h10-12H,4-9H2,1-3H3 |
| InChIKey | XAQTYYLHPYCJNV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|