C9H18N2 — CID 90720386
1,2-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine (PubChem CID 90720386) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 1,2-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine.
| Compound Name | 1,2-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 90720386 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1,2-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine |
| SMILES | CC1CN2CCCCC2N1C |
| InChI | InChI=1S/C9H18N2/c1-8-7-11-6-4-3-5-9(11)10(8)2/h8-9H,3-7H2,1-2H3 |
| InChIKey | GMOAAZXHNVFKOC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |