C10H20IN — CID 135254907
(2S,3R)-2-(2,2-dimethylpropyl)-1-iodo-3-methylpyrrolidine (PubChem CID 135254907) has the molecular formula C10H20IN and a molecular weight of 281.18 g/mol. Its IUPAC name is (2S,3R)-2-(2,2-dimethylpropyl)-1-iodo-3-methylpyrrolidine.
| Compound Name | (2S,3R)-2-(2,2-dimethylpropyl)-1-iodo-3-methylpyrrolidine |
|---|---|
| PubChem CID | 135254907 |
| Molecular Formula | C10H20IN |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | (2S,3R)-2-(2,2-dimethylpropyl)-1-iodo-3-methylpyrrolidine |
| SMILES | C[C@@H]1CCN(I)[C@H]1CC(C)(C)C |
| InChI | InChI=1S/C10H20IN/c1-8-5-6-12(11)9(8)7-10(2,3)4/h8-9H,5-7H2,1-4H3/t8-,9+/m1/s1 |
| InChIKey | ZYJLNMDAQJVKKI-BDAKNGLRSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|