C10H11BrF4N2O — CID 90373032
(2S,4S)-4-amino-4-(5-bromo-2-fluoro-3-pyridinyl)-1,1,1-trifluoropentan-2-ol (PubChem CID 90373032) has the molecular formula C10H11BrF4N2O and a molecular weight of 331.11 g/mol. Its IUPAC name is (2S,4S)-4-amino-4-(5-bromo-2-fluoro-3-pyridinyl)-1,1,1-trifluoropentan-2-ol.
| Compound Name | (2S,4S)-4-amino-4-(5-bromo-2-fluoro-3-pyridinyl)-1,1,1-trifluoropentan-2-ol |
|---|---|
| PubChem CID | 90373032 |
| Molecular Formula | C10H11BrF4N2O |
| Molecular Weight | 331.11 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | (2S,4S)-4-amino-4-(5-bromo-2-fluoro-3-pyridinyl)-1,1,1-trifluoropentan-2-ol |
| SMILES | C[C@](N)(C[C@H](O)C(F)(F)F)c1cc(Br)cnc1F |
| InChI | InChI=1S/C10H11BrF4N2O/c1-9(16,3-7(18)10(13,14)15)6-2-5(11)4-17-8(6)12/h2,4,7,18H,3,16H2,1H3/t7-,9-/m0/s1 |
| InChIKey | AUQZEFXSABDBFK-CBAPKCEASA-N |
| XLogP | 2.47 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.11 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|