C11H12F5NO — CID 90308192
(4S)-4-amino-4-(2,6-difluorophenyl)-1,1,1-trifluoropentan-2-ol (PubChem CID 90308192) has the molecular formula C11H12F5NO and a molecular weight of 269.21 g/mol. Its IUPAC name is (4S)-4-amino-4-(2,6-difluorophenyl)-1,1,1-trifluoropentan-2-ol.
| Compound Name | (4S)-4-amino-4-(2,6-difluorophenyl)-1,1,1-trifluoropentan-2-ol |
|---|---|
| PubChem CID | 90308192 |
| Molecular Formula | C11H12F5NO |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (4S)-4-amino-4-(2,6-difluorophenyl)-1,1,1-trifluoropentan-2-ol |
| SMILES | C[C@](N)(CC(O)C(F)(F)F)c1c(F)cccc1F |
| InChI | InChI=1S/C11H12F5NO/c1-10(17,5-8(18)11(14,15)16)9-6(12)3-2-4-7(9)13/h2-4,8,18H,5,17H2,1H3/t8?,10-/m0/s1 |
| InChIKey | ZOXGTISJRIBFOK-HTLJXXAVSA-N |
| XLogP | 2.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |