C12H15BrFNOS — CID 90373174
(NZ,R)-N-[1-(3-bromophenyl)-2-fluoroethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 90373174) has the molecular formula C12H15BrFNOS and a molecular weight of 320.23 g/mol. Its IUPAC name is (NZ,R)-N-[1-(3-bromophenyl)-2-fluoroethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ,R)-N-[1-(3-bromophenyl)-2-fluoroethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 90373174 |
| Molecular Formula | C12H15BrFNOS |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | (NZ,R)-N-[1-(3-bromophenyl)-2-fluoroethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C(\CF)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrFNOS/c1-12(2,3)17(16)15-11(8-14)9-5-4-6-10(13)7-9/h4-7H,8H2,1-3H3/b15-11+/t17-/m1/s1 |
| InChIKey | DBVITPJTPJASMC-GSPCDJLXSA-N |
| XLogP | 3.67 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|