C14H19BrClNOS — CID 46188321
(NE,S)-N-[1-(4-bromophenyl)-4-chlorobutylidene]-2-methylpropane-2-sulfinamide (PubChem CID 46188321) has the molecular formula C14H19BrClNOS and a molecular weight of 364.74 g/mol. Its IUPAC name is (NE,S)-N-[1-(4-bromophenyl)-4-chlorobutylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[1-(4-bromophenyl)-4-chlorobutylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 46188321 |
| Molecular Formula | C14H19BrClNOS |
| Molecular Weight | 364.74 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | (NE,S)-N-[1-(4-bromophenyl)-4-chlorobutylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)/N=C(\CCCCl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H19BrClNOS/c1-14(2,3)19(18)17-13(5-4-10-16)11-6-8-12(15)9-7-11/h6-9H,4-5,10H2,1-3H3/b17-13+/t19-/m0/s1 |
| InChIKey | IVAPJZQCMFZMAB-UMEYKSNOSA-N |
| XLogP | 4.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|