C12H14BrF2NOS — CID 139530985
(NZ)-N-[1-(4-bromophenyl)-2,2-difluoroethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 139530985) has the molecular formula C12H14BrF2NOS and a molecular weight of 338.22 g/mol. Its IUPAC name is (NZ)-N-[1-(4-bromophenyl)-2,2-difluoroethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ)-N-[1-(4-bromophenyl)-2,2-difluoroethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 139530985 |
| Molecular Formula | C12H14BrF2NOS |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | (NZ)-N-[1-(4-bromophenyl)-2,2-difluoroethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)/N=C(/c1ccc(Br)cc1)C(F)F |
| InChI | InChI=1S/C12H14BrF2NOS/c1-12(2,3)18(17)16-10(11(14)15)8-4-6-9(13)7-5-8/h4-7,11H,1-3H3/b16-10- |
| InChIKey | PRFACJIMAOJYPR-YBEGLDIGSA-N |
| XLogP | 3.97 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|