C14H20ClNOS — CID 46188495
(NE,S)-N-(4-chloro-1-phenylbutylidene)-2-methylpropane-2-sulfinamide (PubChem CID 46188495) has the molecular formula C14H20ClNOS and a molecular weight of 285.84 g/mol. Its IUPAC name is (NE,S)-N-(4-chloro-1-phenylbutylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-(4-chloro-1-phenylbutylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 46188495 |
| Molecular Formula | C14H20ClNOS |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (NE,S)-N-(4-chloro-1-phenylbutylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)/N=C(\CCCCl)c1ccccc1 |
| InChI | InChI=1S/C14H20ClNOS/c1-14(2,3)18(17)16-13(10-7-11-15)12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3/b16-13+/t18-/m0/s1 |
| InChIKey | WQPMNYCWWRCVAJ-QCUIPMNBSA-N |
| XLogP | 3.96 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|