C15H22ClNOS — CID 46188496
(NE,S)-N-[4-chloro-1-(4-methylphenyl)butylidene]-2-methylpropane-2-sulfinamide (PubChem CID 46188496) has the molecular formula C15H22ClNOS and a molecular weight of 299.87 g/mol. Its IUPAC name is (NE,S)-N-[4-chloro-1-(4-methylphenyl)butylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[4-chloro-1-(4-methylphenyl)butylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 46188496 |
| Molecular Formula | C15H22ClNOS |
| Molecular Weight | 299.87 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (NE,S)-N-[4-chloro-1-(4-methylphenyl)butylidene]-2-methylpropane-2-sulfinamide |
| SMILES | Cc1ccc(/C(CCCCl)=N/[S@@](=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H22ClNOS/c1-12-7-9-13(10-8-12)14(6-5-11-16)17-19(18)15(2,3)4/h7-10H,5-6,11H2,1-4H3/b17-14+/t19-/m0/s1 |
| InChIKey | PEDQTEUYNDXJSL-FLXZHSAZSA-N |
| XLogP | 4.27 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|