C19H27F3N4O4 — CID 90375029
2-[[2-[[4-(diethylamino)butyl-(2,2,2-trifluoroacetyl)amino]methyl]-4-pyridinyl]methylamino]-2-oxoacetic acid (PubChem CID 90375029) has the molecular formula C19H27F3N4O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is 2-[[2-[[4-(diethylamino)butyl-(2,2,2-trifluoroacetyl)amino]methyl]-4-pyridinyl]methylamino]-2-oxoacetic acid.
| Compound Name | 2-[[2-[[4-(diethylamino)butyl-(2,2,2-trifluoroacetyl)amino]methyl]-4-pyridinyl]methylamino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 90375029 |
| Molecular Formula | C19H27F3N4O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-[[2-[[4-(diethylamino)butyl-(2,2,2-trifluoroacetyl)amino]methyl]-4-pyridinyl]methylamino]-2-oxoacetic acid |
| SMILES | CCN(CC)CCCCN(Cc1cc(CNC(=O)C(=O)O)ccn1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C19H27F3N4O4/c1-3-25(4-2)9-5-6-10-26(18(30)19(20,21)22)13-15-11-14(7-8-23-15)12-24-16(27)17(28)29/h7-8,11H,3-6,9-10,12-13H2,1-2H3,(H,24,27)(H,28,29) |
| InChIKey | LFVCCWPWMHYBJX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|