C13H14F3N3O3 — CID 90375035
N-[2-(dimethylamino)-2-oxoethyl]-2,2,2-trifluoro-N-[(4-formyl-2-pyridinyl)methyl]acetamide (PubChem CID 90375035) has the molecular formula C13H14F3N3O3 and a molecular weight of 317.27 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-2,2,2-trifluoro-N-[(4-formyl-2-pyridinyl)methyl]acetamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-2,2,2-trifluoro-N-[(4-formyl-2-pyridinyl)methyl]acetamide |
|---|---|
| PubChem CID | 90375035 |
| Molecular Formula | C13H14F3N3O3 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-2,2,2-trifluoro-N-[(4-formyl-2-pyridinyl)methyl]acetamide |
| SMILES | CN(C)C(=O)CN(Cc1cc(C=O)ccn1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H14F3N3O3/c1-18(2)11(21)7-19(12(22)13(14,15)16)6-10-5-9(8-20)3-4-17-10/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | UMJUPEYUDRCOJC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|