C16H12BrF2NO3 — CID 90375275
4-bromo-N-[(1S)-1-(2,6-difluorophenyl)-2-oxoethyl]-3-methoxybenzamide (PubChem CID 90375275) has the molecular formula C16H12BrF2NO3 and a molecular weight of 384.18 g/mol. Its IUPAC name is 4-bromo-N-[(1S)-1-(2,6-difluorophenyl)-2-oxoethyl]-3-methoxybenzamide.
| Compound Name | 4-bromo-N-[(1S)-1-(2,6-difluorophenyl)-2-oxoethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 90375275 |
| Molecular Formula | C16H12BrF2NO3 |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 4-bromo-N-[(1S)-1-(2,6-difluorophenyl)-2-oxoethyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)N[C@H](C=O)c2c(F)cccc2F)ccc1Br |
| InChI | InChI=1S/C16H12BrF2NO3/c1-23-14-7-9(5-6-10(14)17)16(22)20-13(8-21)15-11(18)3-2-4-12(15)19/h2-8,13H,1H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | KTDOIWIVZYOPCE-CYBMUJFWSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|