C10H10BrF2N3 — CID 90376372
7-bromo-N-(2,2-difluoroethyl)-1-methylindazol-3-amine (PubChem CID 90376372) has the molecular formula C10H10BrF2N3 and a molecular weight of 290.11 g/mol. Its IUPAC name is 7-bromo-N-(2,2-difluoroethyl)-1-methylindazol-3-amine.
| Compound Name | 7-bromo-N-(2,2-difluoroethyl)-1-methylindazol-3-amine |
|---|---|
| PubChem CID | 90376372 |
| Molecular Formula | C10H10BrF2N3 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 7-bromo-N-(2,2-difluoroethyl)-1-methylindazol-3-amine |
| SMILES | Cn1nc(NCC(F)F)c2cccc(Br)c21 |
| InChI | InChI=1S/C10H10BrF2N3/c1-16-9-6(3-2-4-7(9)11)10(15-16)14-5-8(12)13/h2-4,8H,5H2,1H3,(H,14,15) |
| InChIKey | GUNXNUDWHQGMPC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |