C21H34O — CID 90379457
(2S,3S,5S,8R,9S,10S,13S,14S)-2,10,13-trimethyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 90379457) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is (2S,3S,5S,8R,9S,10S,13S,14S)-2,10,13-trimethyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (2S,3S,5S,8R,9S,10S,13S,14S)-2,10,13-trimethyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 90379457 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | (2S,3S,5S,8R,9S,10S,13S,14S)-2,10,13-trimethyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C=C1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](O)[C@@H](C)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H34O/c1-13-12-21(4)15(11-19(13)22)6-7-16-17-8-5-14(2)20(17,3)10-9-18(16)21/h13,15-19,22H,2,5-12H2,1,3-4H3/t13-,15-,16-,17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | KQZHEIYRRJHURH-HCBXVSRCSA-N |
| XLogP | 5.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|