C13H11ClN2O3 — CID 90380857
(E)-3-[2-chloro-4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]prop-2-enoic acid (PubChem CID 90380857) has the molecular formula C13H11ClN2O3 and a molecular weight of 278.69 g/mol. Its IUPAC name is (E)-3-[2-chloro-4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-chloro-4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90380857 |
| Molecular Formula | C13H11ClN2O3 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (E)-3-[2-chloro-4-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]prop-2-enoic acid |
| SMILES | CCc1nnc(-c2ccc(/C=C/C(=O)O)c(Cl)c2)o1 |
| InChI | InChI=1S/C13H11ClN2O3/c1-2-11-15-16-13(19-11)9-4-3-8(10(14)7-9)5-6-12(17)18/h3-7H,2H2,1H3,(H,17,18)/b6-5+ |
| InChIKey | NFSVZTAFWUHLII-AATRIKPKSA-N |
| XLogP | 3.05 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|