C21H34O3 — CID 90382092
(1R,2S,5S,6R,12S,13S,16R,18S)-6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosane-8,16-diol (PubChem CID 90382092) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (1R,2S,5S,6R,12S,13S,16R,18S)-6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosane-8,16-diol.
| Compound Name | (1R,2S,5S,6R,12S,13S,16R,18S)-6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosane-8,16-diol |
|---|---|
| PubChem CID | 90382092 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (1R,2S,5S,6R,12S,13S,16R,18S)-6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosane-8,16-diol |
| SMILES | C[C@H]1OC(O)C23CC[C@H]4[C@@H](CC[C@H]5C[C@H](O)CC[C@@]54C)[C@@H]2CC[C@H]13 |
| InChI | InChI=1S/C21H34O3/c1-12-16-5-6-18-15-4-3-13-11-14(22)7-9-20(13,2)17(15)8-10-21(16,18)19(23)24-12/h12-19,22-23H,3-11H2,1-2H3/t12-,13+,14-,15-,16-,17+,18+,19?,20+,21?/m1/s1 |
| InChIKey | ZGMMKFKUROZMDN-UUHPFQTJSA-N |
| XLogP | 3.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |