C21H28FN7O3S — CID 90382576
3,3-diamino-N-[4-[4-(azetidin-1-ylsulfonyl)phenyl]-3-pyridinyl]-2-(5-fluoro-1,3-diazinan-2-yl)propanamide (PubChem CID 90382576) has the molecular formula C21H28FN7O3S and a molecular weight of 477.57 g/mol. Its IUPAC name is 3,3-diamino-N-[4-[4-(azetidin-1-ylsulfonyl)phenyl]-3-pyridinyl]-2-(5-fluoro-1,3-diazinan-2-yl)propanamide.
| Compound Name | 3,3-diamino-N-[4-[4-(azetidin-1-ylsulfonyl)phenyl]-3-pyridinyl]-2-(5-fluoro-1,3-diazinan-2-yl)propanamide |
|---|---|
| PubChem CID | 90382576 |
| Molecular Formula | C21H28FN7O3S |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 3,3-diamino-N-[4-[4-(azetidin-1-ylsulfonyl)phenyl]-3-pyridinyl]-2-(5-fluoro-1,3-diazinan-2-yl)propanamide |
| SMILES | NC(N)C(C(=O)Nc1cnccc1-c1ccc(S(=O)(=O)N2CCC2)cc1)C1NCC(F)CN1 |
| InChI | InChI=1S/C21H28FN7O3S/c22-14-10-26-20(27-11-14)18(19(23)24)21(30)28-17-12-25-7-6-16(17)13-2-4-15(5-3-13)33(31,32)29-8-1-9-29/h2-7,12,14,18-20,26-27H,1,8-11,23-24H2,(H,28,30) |
| InChIKey | FMGYFQNTUIQYCA-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 155.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|