C14H18ClF3N6O3 — CID 90382537
3-amino-2-(5-chloro-1,3-diazinan-2-yl)-3-nitroso-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide (PubChem CID 90382537) has the molecular formula C14H18ClF3N6O3 and a molecular weight of 410.78 g/mol. Its IUPAC name is 3-amino-2-(5-chloro-1,3-diazinan-2-yl)-3-nitroso-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide.
| Compound Name | 3-amino-2-(5-chloro-1,3-diazinan-2-yl)-3-nitroso-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 90382537 |
| Molecular Formula | C14H18ClF3N6O3 |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 3-amino-2-(5-chloro-1,3-diazinan-2-yl)-3-nitroso-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide |
| SMILES | NC(N=O)C(C(=O)Nc1cnccc1OCC(F)(F)F)C1NCC(Cl)CN1 |
| InChI | InChI=1S/C14H18ClF3N6O3/c15-7-3-21-12(22-4-7)10(11(19)24-26)13(25)23-8-5-20-2-1-9(8)27-6-14(16,17)18/h1-2,5,7,10-12,21-22H,3-4,6,19H2,(H,23,25) |
| InChIKey | VUROPZBOBFDFJZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|