C16H25N7O2 — CID 90212049
3,3-diamino-2-[5-(1-cyanoethyl)-1,3-diazinan-2-yl]-N-(4-methoxy-3-pyridinyl)propanamide (PubChem CID 90212049) has the molecular formula C16H25N7O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 3,3-diamino-2-[5-(1-cyanoethyl)-1,3-diazinan-2-yl]-N-(4-methoxy-3-pyridinyl)propanamide.
| Compound Name | 3,3-diamino-2-[5-(1-cyanoethyl)-1,3-diazinan-2-yl]-N-(4-methoxy-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 90212049 |
| Molecular Formula | C16H25N7O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 3,3-diamino-2-[5-(1-cyanoethyl)-1,3-diazinan-2-yl]-N-(4-methoxy-3-pyridinyl)propanamide |
| SMILES | COc1ccncc1NC(=O)C(C(N)N)C1NCC(C(C)C#N)CN1 |
| InChI | InChI=1S/C16H25N7O2/c1-9(5-17)10-6-21-15(22-7-10)13(14(18)19)16(24)23-11-8-20-4-3-12(11)25-2/h3-4,8-10,13-15,21-22H,6-7,18-19H2,1-2H3,(H,23,24) |
| InChIKey | CZJJOXCHADLSOU-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 151.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|