C20H33ClN8O2 — CID 90382353
3-amino-N-[4-(4-tert-butylpiperazin-1-yl)-3-pyridinyl]-2-(5-chloro-1,3-diazinan-2-yl)-3-nitrosopropanamide (PubChem CID 90382353) has the molecular formula C20H33ClN8O2 and a molecular weight of 452.99 g/mol. Its IUPAC name is 3-amino-N-[4-(4-tert-butylpiperazin-1-yl)-3-pyridinyl]-2-(5-chloro-1,3-diazinan-2-yl)-3-nitrosopropanamide.
| Compound Name | 3-amino-N-[4-(4-tert-butylpiperazin-1-yl)-3-pyridinyl]-2-(5-chloro-1,3-diazinan-2-yl)-3-nitrosopropanamide |
|---|---|
| PubChem CID | 90382353 |
| Molecular Formula | C20H33ClN8O2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 3-amino-N-[4-(4-tert-butylpiperazin-1-yl)-3-pyridinyl]-2-(5-chloro-1,3-diazinan-2-yl)-3-nitrosopropanamide |
| SMILES | CC(C)(C)N1CCN(c2ccncc2NC(=O)C(C(N)N=O)C2NCC(Cl)CN2)CC1 |
| InChI | InChI=1S/C20H33ClN8O2/c1-20(2,3)29-8-6-28(7-9-29)15-4-5-23-12-14(15)26-19(30)16(17(22)27-31)18-24-10-13(21)11-25-18/h4-5,12-13,16-18,24-25H,6-11,22H2,1-3H3,(H,26,30) |
| InChIKey | CUALYBHWENYONP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|