C23H37ClFN9O2 — CID 90212076
3,3-diamino-2-(5-chloro-1,3-diazinan-2-yl)-N-[5-fluoro-4-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]-3-pyridinyl]propanamide (PubChem CID 90212076) has the molecular formula C23H37ClFN9O2 and a molecular weight of 526.06 g/mol. Its IUPAC name is 3,3-diamino-2-(5-chloro-1,3-diazinan-2-yl)-N-[5-fluoro-4-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]-3-pyridinyl]propanamide.
| Compound Name | 3,3-diamino-2-(5-chloro-1,3-diazinan-2-yl)-N-[5-fluoro-4-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 90212076 |
| Molecular Formula | C23H37ClFN9O2 |
| Molecular Weight | 526.06 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 3,3-diamino-2-(5-chloro-1,3-diazinan-2-yl)-N-[5-fluoro-4-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]-3-pyridinyl]propanamide |
| SMILES | CN1CCN(C(=O)C2CCN(c3c(F)cncc3NC(=O)C(C(N)N)C3NCC(Cl)CN3)CC2)CC1 |
| InChI | InChI=1S/C23H37ClFN9O2/c1-32-6-8-34(9-7-32)23(36)14-2-4-33(5-3-14)19-16(25)12-28-13-17(19)31-22(35)18(20(26)27)21-29-10-15(24)11-30-21/h12-15,18,20-21,29-30H,2-11,26-27H2,1H3,(H,31,35) |
| InChIKey | JRRQOTJOGKYZAM-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 144.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.06 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|