C33H56FN7O3 — CID 138645381
3,3-diamino-2-[(4R)-7-fluoro-4-methyl-4-pentylazocan-2-yl]-N-[4-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]oxy-3-pyridinyl]propanamide (PubChem CID 138645381) has the molecular formula C33H56FN7O3 and a molecular weight of 617.86 g/mol. Its IUPAC name is 3,3-diamino-2-[(4R)-7-fluoro-4-methyl-4-pentylazocan-2-yl]-N-[4-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]oxy-3-pyridinyl]propanamide.
| Compound Name | 3,3-diamino-2-[(4R)-7-fluoro-4-methyl-4-pentylazocan-2-yl]-N-[4-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]oxy-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 138645381 |
| Molecular Formula | C33H56FN7O3 |
| Molecular Weight | 617.86 g/mol |
| Exact Mass | 617.44 |
| IUPAC Name | 3,3-diamino-2-[(4R)-7-fluoro-4-methyl-4-pentylazocan-2-yl]-N-[4-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]oxy-3-pyridinyl]propanamide |
| SMILES | CCCCC[C@]1(C)CCC(F)CNC(C(C(=O)Nc2cnccc2OC2CCC(C(=O)N3CCN(C)CC3)CC2)C(N)N)C1 |
| InChI | InChI=1S/C33H56FN7O3/c1-4-5-6-13-33(2)14-11-24(34)21-38-26(20-33)29(30(35)36)31(42)39-27-22-37-15-12-28(27)44-25-9-7-23(8-10-25)32(43)41-18-16-40(3)17-19-41/h12,15,22-26,29-30,38H,4-11,13-14,16-21,35-36H2,1-3H3,(H,39,42)/t23?,24?,25?,26?,29?,33-/m1/s1 |
| InChIKey | IDJDFRDKLYUSKY-PJLDQUEFSA-N |
| XLogP | 3.66 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|