C17H28ClFN8O — CID 90212172
3,3-diamino-N-[5-chloro-4-(4-methylpiperazin-1-yl)-3-pyridinyl]-2-(5-fluoro-1,3-diazinan-2-yl)propanamide (PubChem CID 90212172) has the molecular formula C17H28ClFN8O and a molecular weight of 414.92 g/mol. Its IUPAC name is 3,3-diamino-N-[5-chloro-4-(4-methylpiperazin-1-yl)-3-pyridinyl]-2-(5-fluoro-1,3-diazinan-2-yl)propanamide.
| Compound Name | 3,3-diamino-N-[5-chloro-4-(4-methylpiperazin-1-yl)-3-pyridinyl]-2-(5-fluoro-1,3-diazinan-2-yl)propanamide |
|---|---|
| PubChem CID | 90212172 |
| Molecular Formula | C17H28ClFN8O |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 3,3-diamino-N-[5-chloro-4-(4-methylpiperazin-1-yl)-3-pyridinyl]-2-(5-fluoro-1,3-diazinan-2-yl)propanamide |
| SMILES | CN1CCN(c2c(Cl)cncc2NC(=O)C(C(N)N)C2NCC(F)CN2)CC1 |
| InChI | InChI=1S/C17H28ClFN8O/c1-26-2-4-27(5-3-26)14-11(18)8-22-9-12(14)25-17(28)13(15(20)21)16-23-6-10(19)7-24-16/h8-10,13,15-16,23-24H,2-7,20-21H2,1H3,(H,25,28) |
| InChIKey | USHCOZUKNAFYMI-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|