C19H30N8O2 — CID 90212011
3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-(4-piperidin-4-yloxy-3-pyridinyl)propanamide (PubChem CID 90212011) has the molecular formula C19H30N8O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-(4-piperidin-4-yloxy-3-pyridinyl)propanamide.
| Compound Name | 3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-(4-piperidin-4-yloxy-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 90212011 |
| Molecular Formula | C19H30N8O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-(4-piperidin-4-yloxy-3-pyridinyl)propanamide |
| SMILES | N#CCC1CNC(C(C(=O)Nc2cnccc2OC2CCNCC2)C(N)N)NC1 |
| InChI | InChI=1S/C19H30N8O2/c20-5-1-12-9-25-18(26-10-12)16(17(21)22)19(28)27-14-11-24-8-4-15(14)29-13-2-6-23-7-3-13/h4,8,11-13,16-18,23,25-26H,1-3,6-7,9-10,21-22H2,(H,27,28) |
| InChIKey | PQIUHSJSQDAFRJ-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|