C13H16N2O4S — CID 172853666
N-[4-(1,1-dioxothian-4-yl)oxy-3-pyridinyl]prop-2-enamide (PubChem CID 172853666) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is N-[4-(1,1-dioxothian-4-yl)oxy-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[4-(1,1-dioxothian-4-yl)oxy-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 172853666 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[4-(1,1-dioxothian-4-yl)oxy-3-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cnccc1OC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H16N2O4S/c1-2-13(16)15-11-9-14-6-3-12(11)19-10-4-7-20(17,18)8-5-10/h2-3,6,9-10H,1,4-5,7-8H2,(H,15,16) |
| InChIKey | YKFRETXXDYOGNN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|