C18H22N2O2 — CID 90382736
(1-methoxynaphthalen-2-yl)-[4-(methylamino)piperidin-1-yl]methanone (PubChem CID 90382736) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (1-methoxynaphthalen-2-yl)-[4-(methylamino)piperidin-1-yl]methanone.
| Compound Name | (1-methoxynaphthalen-2-yl)-[4-(methylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 90382736 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (1-methoxynaphthalen-2-yl)-[4-(methylamino)piperidin-1-yl]methanone |
| SMILES | CNC1CCN(C(=O)c2ccc3ccccc3c2OC)CC1 |
| InChI | InChI=1S/C18H22N2O2/c1-19-14-9-11-20(12-10-14)18(21)16-8-7-13-5-3-4-6-15(13)17(16)22-2/h3-8,14,19H,9-12H2,1-2H3 |
| InChIKey | KCLIGCGZXCENCZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |