C17H18N4O3S — CID 90383004
6-methoxy-8-[3-(methoxyamino)phenyl]-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 90383004) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 6-methoxy-8-[3-(methoxyamino)phenyl]-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-methoxy-8-[3-(methoxyamino)phenyl]-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 90383004 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 6-methoxy-8-[3-(methoxyamino)phenyl]-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CONc1cccc(-n2c(=O)c(OC)c(C)c3cnc(SC)nc32)c1 |
| InChI | InChI=1S/C17H18N4O3S/c1-10-13-9-18-17(25-4)19-15(13)21(16(22)14(10)23-2)12-7-5-6-11(8-12)20-24-3/h5-9,20H,1-4H3 |
| InChIKey | WRVLIFSMZULWRD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|