C21H18ClF2N7OS — CID 90383121
4-[5-chloro-4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide (PubChem CID 90383121) has the molecular formula C21H18ClF2N7OS and a molecular weight of 489.94 g/mol. Its IUPAC name is 4-[5-chloro-4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide.
| Compound Name | 4-[5-chloro-4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90383121 |
| Molecular Formula | C21H18ClF2N7OS |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 4-[5-chloro-4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide |
| SMILES | Cn1ncc(-c2nc(C(F)F)c(Cl)s2)c1C(=O)NC1CCn2nc(-c3ccccc3)nc2C1 |
| InChI | InChI=1S/C21H18ClF2N7OS/c1-30-16(13(10-25-30)21-28-15(18(23)24)17(22)33-21)20(32)26-12-7-8-31-14(9-12)27-19(29-31)11-5-3-2-4-6-11/h2-6,10,12,18H,7-9H2,1H3,(H,26,32) |
| InChIKey | VTZHNCRPXFLXLE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |