C18H16BN3O3 — CID 90383768
CID 90383768 (PubChem CID 90383768) has the molecular formula C18H16BN3O3 and a molecular weight of 333.16 g/mol.
| Compound Name | CID 90383768 |
|---|---|
| PubChem CID | 90383768 |
| Molecular Formula | C18H16BN3O3 |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(N)=O)c2[nH]c3ccc(C(=O)N4CCOCC4)cc3c2c1 |
| InChI | InChI=1S/C18H16BN3O3/c19-11-8-13-12-7-10(18(24)22-3-5-25-6-4-22)1-2-15(12)21-16(13)14(9-11)17(20)23/h1-2,7-9,21H,3-6H2,(H2,20,23) |
| InChIKey | QFSZZMDAJPWRRZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|