About 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole
1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole (PubChem CID 90388367) has the molecular formula C17H15ClN4O
and a molecular weight of 326.79 g/mol. Its IUPAC name is 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole |
| PubChem CID | 90388367 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole |
| SMILES | COc1cc2c(cc1-c1c(C)n[nH]c1C)[nH]c1ccnc(Cl)c12 |
| InChI | InChI=1S/C17H15ClN4O/c1-8-15(9(2)22-21-8)11-6-13-10(7-14(11)23-3)16-12(20-13)4-5-19-17(16)18/h4-7,20H,1-3H3,(H,21,22) |
| InChIKey | QGSWOCCDAUKNAQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole?
The IUPAC name of 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole (CID 90388367) is 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole.
What is the SMILES notation for 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole?
The canonical SMILES for 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole is COc1cc2c(cc1-c1c(C)n[nH]c1C)[nH]c1ccnc(Cl)c12.
What is the InChIKey of 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole?
The InChIKey is QGSWOCCDAUKNAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN4O/c1-8-15(9(2)22-21-8)11-6-13-10(7-14(11)23-3)16-12(20-13)4-5-19-17(16)18/h4-7,20H,1-3H3,(H,21,22).
What are the key properties of 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole?
1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole has a molecular weight of 326.79 g/mol, XLogP of 4.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-7-(3,5-dimethyl-1H-pyrazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole is sourced from PubChem (CID 90388367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).