About 2-prop-2-ynylpent-4-ynyl hydrogen carbonate
2-prop-2-ynylpent-4-ynyl hydrogen carbonate (PubChem CID 90390377) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-prop-2-ynylpent-4-ynyl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-prop-2-ynylpent-4-ynyl hydrogen carbonate |
| PubChem CID | 90390377 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-prop-2-ynylpent-4-ynyl hydrogen carbonate |
| SMILES | C#CCC(CC#C)COC(=O)O |
| InChI | InChI=1S/C9H10O3/c1-3-5-8(6-4-2)7-12-9(10)11/h1-2,8H,5-7H2,(H,10,11) |
| InChIKey | YGIRVGVDDQVKRM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-ynylpent-4-ynyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-ynylpent-4-ynyl hydrogen carbonate?
The IUPAC name of 2-prop-2-ynylpent-4-ynyl hydrogen carbonate (CID 90390377) is 2-prop-2-ynylpent-4-ynyl hydrogen carbonate.
What is the SMILES notation for 2-prop-2-ynylpent-4-ynyl hydrogen carbonate?
The canonical SMILES for 2-prop-2-ynylpent-4-ynyl hydrogen carbonate is C#CCC(CC#C)COC(=O)O.
What is the InChIKey of 2-prop-2-ynylpent-4-ynyl hydrogen carbonate?
The InChIKey is YGIRVGVDDQVKRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-3-5-8(6-4-2)7-12-9(10)11/h1-2,8H,5-7H2,(H,10,11).
What are the key properties of 2-prop-2-ynylpent-4-ynyl hydrogen carbonate?
2-prop-2-ynylpent-4-ynyl hydrogen carbonate has a molecular weight of 166.18 g/mol, XLogP of 1.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-ynylpent-4-ynyl hydrogen carbonate is sourced from PubChem (CID 90390377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).