C34H38FN5O3Si — CID 90391196
2-[[5-(2-fluoro-4-phenylmethoxy-3-pyridinyl)-3-(2-morpholin-4-yl-4-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 90391196) has the molecular formula C34H38FN5O3Si and a molecular weight of 611.79 g/mol. Its IUPAC name is 2-[[5-(2-fluoro-4-phenylmethoxy-3-pyridinyl)-3-(2-morpholin-4-yl-4-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(2-fluoro-4-phenylmethoxy-3-pyridinyl)-3-(2-morpholin-4-yl-4-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 90391196 |
| Molecular Formula | C34H38FN5O3Si |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | 2-[[5-(2-fluoro-4-phenylmethoxy-3-pyridinyl)-3-(2-morpholin-4-yl-4-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2ccnc(N3CCOCC3)c2)c2cc(-c3c(OCc4ccccc4)ccnc3F)ccc21 |
| InChI | InChI=1S/C34H38FN5O3Si/c1-44(2,3)20-19-42-24-40-29-10-9-26(32-30(12-14-37-34(32)35)43-23-25-7-5-4-6-8-25)21-28(29)33(38-40)27-11-13-36-31(22-27)39-15-17-41-18-16-39/h4-14,21-22H,15-20,23-24H2,1-3H3 |
| InChIKey | RFLLBIFQJCBPBY-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|