C31H36ClN5O2 — CID 46898659
4-[5-[1-[(4-chlorophenyl)methyl]-3-[3-[(2S)-2-methylpyrrolidin-1-yl]propoxy]indazol-5-yl]-2-pyridinyl]morpholine (PubChem CID 46898659) has the molecular formula C31H36ClN5O2 and a molecular weight of 546.12 g/mol. Its IUPAC name is 4-[5-[1-[(4-chlorophenyl)methyl]-3-[3-[(2S)-2-methylpyrrolidin-1-yl]propoxy]indazol-5-yl]-2-pyridinyl]morpholine.
| Compound Name | 4-[5-[1-[(4-chlorophenyl)methyl]-3-[3-[(2S)-2-methylpyrrolidin-1-yl]propoxy]indazol-5-yl]-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 46898659 |
| Molecular Formula | C31H36ClN5O2 |
| Molecular Weight | 546.12 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 4-[5-[1-[(4-chlorophenyl)methyl]-3-[3-[(2S)-2-methylpyrrolidin-1-yl]propoxy]indazol-5-yl]-2-pyridinyl]morpholine |
| SMILES | C[C@H]1CCCN1CCCOc1nn(Cc2ccc(Cl)cc2)c2ccc(-c3ccc(N4CCOCC4)nc3)cc12 |
| InChI | InChI=1S/C31H36ClN5O2/c1-23-4-2-13-35(23)14-3-17-39-31-28-20-25(26-8-12-30(33-21-26)36-15-18-38-19-16-36)7-11-29(28)37(34-31)22-24-5-9-27(32)10-6-24/h5-12,20-21,23H,2-4,13-19,22H2,1H3/t23-/m0/s1 |
| InChIKey | BDZXHJKZIBGYHE-QHCPKHFHSA-N |
| XLogP | 5.89 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.12 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|