C21H29NO3 — CID 90392206
(11R,13R)-7-[methyl(prop-2-enyl)amino]-13-propyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,11-diol (PubChem CID 90392206) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (11R,13R)-7-[methyl(prop-2-enyl)amino]-13-propyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,11-diol.
| Compound Name | (11R,13R)-7-[methyl(prop-2-enyl)amino]-13-propyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,11-diol |
|---|---|
| PubChem CID | 90392206 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (11R,13R)-7-[methyl(prop-2-enyl)amino]-13-propyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,11-diol |
| SMILES | C=CCN(C)C1Cc2ccc(O)c3c2[C@@]2(CCC)C1CC[C@@H](O)C2O3 |
| InChI | InChI=1S/C21H29NO3/c1-4-10-21-14-7-9-17(24)20(21)25-19-16(23)8-6-13(18(19)21)12-15(14)22(3)11-5-2/h5-6,8,14-15,17,20,23-24H,2,4,7,9-12H2,1,3H3/t14?,15?,17-,20?,21-/m1/s1 |
| InChIKey | VVZXNPAIZLFDBH-XNHGSCODSA-N |
| XLogP | 3.00 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|