C13H17ClFNO2 — CID 90393866
methyl (2S)-2-[(4-chloro-5-fluoro-2-methylphenyl)methyl-methylamino]propanoate (PubChem CID 90393866) has the molecular formula C13H17ClFNO2 and a molecular weight of 273.74 g/mol. Its IUPAC name is methyl (2S)-2-[(4-chloro-5-fluoro-2-methylphenyl)methyl-methylamino]propanoate.
| Compound Name | methyl (2S)-2-[(4-chloro-5-fluoro-2-methylphenyl)methyl-methylamino]propanoate |
|---|---|
| PubChem CID | 90393866 |
| Molecular Formula | C13H17ClFNO2 |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | methyl (2S)-2-[(4-chloro-5-fluoro-2-methylphenyl)methyl-methylamino]propanoate |
| SMILES | COC(=O)[C@H](C)N(C)Cc1cc(F)c(Cl)cc1C |
| InChI | InChI=1S/C13H17ClFNO2/c1-8-5-11(14)12(15)6-10(8)7-16(3)9(2)13(17)18-4/h5-6,9H,7H2,1-4H3/t9-/m0/s1 |
| InChIKey | DOCHRGUMNMZHPO-VIFPVBQESA-N |
| XLogP | 2.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |