About 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate
1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate (PubChem CID 90397691) has the molecular formula C10H15I2NO6
and a molecular weight of 499.04 g/mol. Its IUPAC name is 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate.
Molecular Properties
| Compound Name | 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate |
| PubChem CID | 90397691 |
| Molecular Formula | C10H15I2NO6 |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.90 |
| IUPAC Name | 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate |
| SMILES | N[C@@H](CC(=O)OCCCI)CC(=O)OCOC(=O)I |
| InChI | InChI=1S/C10H15I2NO6/c11-2-1-3-17-8(14)4-7(13)5-9(15)18-6-19-10(12)16/h7H,1-6,13H2/t7-/m0/s1 |
| InChIKey | HUOHYJTXBXALHS-ZETCQYMHSA-N |
| XLogP | 1.53 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate?
The IUPAC name of 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate (CID 90397691) is 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate.
What is the SMILES notation for 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate?
The canonical SMILES for 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate is N[C@@H](CC(=O)OCCCI)CC(=O)OCOC(=O)I.
What is the InChIKey of 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate?
The InChIKey is HUOHYJTXBXALHS-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H15I2NO6/c11-2-1-3-17-8(14)4-7(13)5-9(15)18-6-19-10(12)16/h7H,1-6,13H2/t7-/m0/s1.
What are the key properties of 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate?
1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate has a molecular weight of 499.04 g/mol, XLogP of 1.53, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(carboniodidoyloxymethyl) 5-O-(3-iodopropyl) (3S)-3-aminopentanedioate is sourced from PubChem (CID 90397691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).