C28H34FN6O4SSi- — CID 90400987
4-[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-2-pyridinyl]piperazine-1-sulfinate (PubChem CID 90400987) has the molecular formula C28H34FN6O4SSi- and a molecular weight of 597.77 g/mol. Its IUPAC name is 4-[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-2-pyridinyl]piperazine-1-sulfinate.
| Compound Name | 4-[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-2-pyridinyl]piperazine-1-sulfinate |
|---|---|
| PubChem CID | 90400987 |
| Molecular Formula | C28H34FN6O4SSi- |
| Molecular Weight | 597.77 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | 4-[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-2-pyridinyl]piperazine-1-sulfinate |
| SMILES | COc1ccnc(F)c1-c1ccc2c(c1)c(-c1ccnc(N3CCN(S(=O)[O-])CC3)c1)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C28H35FN6O4SSi/c1-38-24-8-10-31-28(29)26(24)20-5-6-23-22(17-20)27(32-35(23)19-39-15-16-41(2,3)4)21-7-9-30-25(18-21)33-11-13-34(14-12-33)40(36)37/h5-10,17-18H,11-16,19H2,1-4H3,(H,36,37)/p-1 |
| InChIKey | WGCGBYNYULBZQD-UHFFFAOYSA-M |
| XLogP | 4.54 |
| TPSA | 108.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.77 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|