C21H17BrN4O4 — CID 90403699
3-[7-[(3-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxybenzaldehyde (PubChem CID 90403699) has the molecular formula C21H17BrN4O4 and a molecular weight of 469.30 g/mol. Its IUPAC name is 3-[7-[(3-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxybenzaldehyde.
| Compound Name | 3-[7-[(3-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxybenzaldehyde |
|---|---|
| PubChem CID | 90403699 |
| Molecular Formula | C21H17BrN4O4 |
| Molecular Weight | 469.30 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | 3-[7-[(3-bromophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxybenzaldehyde |
| SMILES | Cn1c(=O)c2c(nc(Oc3cccc(C=O)c3)n2Cc2cccc(Br)c2)n(C)c1=O |
| InChI | InChI=1S/C21H17BrN4O4/c1-24-18-17(19(28)25(2)21(24)29)26(11-13-5-3-7-15(22)9-13)20(23-18)30-16-8-4-6-14(10-16)12-27/h3-10,12H,11H2,1-2H3 |
| InChIKey | ZXVSJMFCFULHJA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|