C12H15F3N4O — CID 90405043
(2S,3R)-2-methyl-3-[[5-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-1-carbaldehyde (PubChem CID 90405043) has the molecular formula C12H15F3N4O and a molecular weight of 288.27 g/mol. Its IUPAC name is (2S,3R)-2-methyl-3-[[5-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-1-carbaldehyde.
| Compound Name | (2S,3R)-2-methyl-3-[[5-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 90405043 |
| Molecular Formula | C12H15F3N4O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (2S,3R)-2-methyl-3-[[5-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-1-carbaldehyde |
| SMILES | C[C@H]1[C@H](Nc2cnc(C(F)(F)F)cn2)CCCN1C=O |
| InChI | InChI=1S/C12H15F3N4O/c1-8-9(3-2-4-19(8)7-20)18-11-6-16-10(5-17-11)12(13,14)15/h5-9H,2-4H2,1H3,(H,17,18)/t8-,9+/m0/s1 |
| InChIKey | HKYZLZXNACIYQW-DTWKUNHWSA-N |
| XLogP | 1.92 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|