C22H24F2N4O3S — CID 90405830
(3R,4S)-N-[2-(4-fluorophenoxy)ethyl]-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine (PubChem CID 90405830) has the molecular formula C22H24F2N4O3S and a molecular weight of 462.52 g/mol. Its IUPAC name is (3R,4S)-N-[2-(4-fluorophenoxy)ethyl]-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3R,4S)-N-[2-(4-fluorophenoxy)ethyl]-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 90405830 |
| Molecular Formula | C22H24F2N4O3S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (3R,4S)-N-[2-(4-fluorophenoxy)ethyl]-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine |
| SMILES | Cn1cnc(S(=O)(=O)N2C[C@H](NCCOc3ccc(F)cc3)[C@@H](c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C22H24F2N4O3S/c1-27-14-22(26-15-27)32(29,30)28-12-20(16-2-4-17(23)5-3-16)21(13-28)25-10-11-31-19-8-6-18(24)7-9-19/h2-9,14-15,20-21,25H,10-13H2,1H3/t20-,21+/m1/s1 |
| InChIKey | HCBYIQOSTPGGOL-RTWAWAEBSA-N |
| XLogP | 2.52 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|