C24H23N7O2 — CID 90409394
5-amino-11-(oxetan-3-yl)-N-(4-phenyl-3-pyridinyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide (PubChem CID 90409394) has the molecular formula C24H23N7O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is 5-amino-11-(oxetan-3-yl)-N-(4-phenyl-3-pyridinyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide.
| Compound Name | 5-amino-11-(oxetan-3-yl)-N-(4-phenyl-3-pyridinyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 90409394 |
| Molecular Formula | C24H23N7O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 5-amino-11-(oxetan-3-yl)-N-(4-phenyl-3-pyridinyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide |
| SMILES | Nc1nn2cc3c(nc2c1C(=O)Nc1cnccc1-c1ccccc1)CCN(C1COC1)C3 |
| InChI | InChI=1S/C24H23N7O2/c25-22-21(24(32)28-20-10-26-8-6-18(20)15-4-2-1-3-5-15)23-27-19-7-9-30(17-13-33-14-17)11-16(19)12-31(23)29-22/h1-6,8,10,12,17H,7,9,11,13-14H2,(H2,25,29)(H,28,32) |
| InChIKey | CLHIVKQWFLHESH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |