C18H20N8O3 — CID 90409943
5-amino-N-(4-methoxypyrimidin-5-yl)-11-(oxetan-3-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide (PubChem CID 90409943) has the molecular formula C18H20N8O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is 5-amino-N-(4-methoxypyrimidin-5-yl)-11-(oxetan-3-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide.
| Compound Name | 5-amino-N-(4-methoxypyrimidin-5-yl)-11-(oxetan-3-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 90409943 |
| Molecular Formula | C18H20N8O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 5-amino-N-(4-methoxypyrimidin-5-yl)-11-(oxetan-3-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide |
| SMILES | COc1ncncc1NC(=O)c1c(N)nn2cc3c(nc12)CCN(C1COC1)C3 |
| InChI | InChI=1S/C18H20N8O3/c1-28-18-13(4-20-9-21-18)23-17(27)14-15(19)24-26-6-10-5-25(11-7-29-8-11)3-2-12(10)22-16(14)26/h4,6,9,11H,2-3,5,7-8H2,1H3,(H2,19,24)(H,23,27) |
| InChIKey | URPYLABXQVIOPA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |