C21H22F3N5O3S — CID 90410087
N-[2,2,2-trifluoro-1-[(3R,4S)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-yl]ethoxy]pyridin-2-amine (PubChem CID 90410087) has the molecular formula C21H22F3N5O3S and a molecular weight of 481.50 g/mol. Its IUPAC name is N-[2,2,2-trifluoro-1-[(3R,4S)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-yl]ethoxy]pyridin-2-amine.
| Compound Name | N-[2,2,2-trifluoro-1-[(3R,4S)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-yl]ethoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 90410087 |
| Molecular Formula | C21H22F3N5O3S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-[2,2,2-trifluoro-1-[(3R,4S)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-yl]ethoxy]pyridin-2-amine |
| SMILES | Cn1cnc(S(=O)(=O)N2C[C@H](c3ccccc3)[C@@H](C(ONc3ccccn3)C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C21H22F3N5O3S/c1-28-13-19(26-14-28)33(30,31)29-11-16(15-7-3-2-4-8-15)17(12-29)20(21(22,23)24)32-27-18-9-5-6-10-25-18/h2-10,13-14,16-17,20H,11-12H2,1H3,(H,25,27)/t16-,17+,20?/m1/s1 |
| InChIKey | XBKLSVRRVMMFRK-LIHHCBPRSA-N |
| XLogP | 3.19 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|