C19H13Cl2F2N5O2 — CID 90415422
(2,3-dichloro-4-fluorophenyl)-[(1S,8R)-5-(3-fluoro-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone (PubChem CID 90415422) has the molecular formula C19H13Cl2F2N5O2 and a molecular weight of 452.25 g/mol. Its IUPAC name is (2,3-dichloro-4-fluorophenyl)-[(1S,8R)-5-(3-fluoro-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone.
| Compound Name | (2,3-dichloro-4-fluorophenyl)-[(1S,8R)-5-(3-fluoro-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
|---|---|
| PubChem CID | 90415422 |
| Molecular Formula | C19H13Cl2F2N5O2 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | (2,3-dichloro-4-fluorophenyl)-[(1S,8R)-5-(3-fluoro-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
| SMILES | O=C(c1ccc(F)c(Cl)c1Cl)N1[C@H]2COC[C@@H]1c1nnc(-c3ncccc3F)n1C2 |
| InChI | InChI=1S/C19H13Cl2F2N5O2/c20-14-10(3-4-11(22)15(14)21)19(29)28-9-6-27-17(13(28)8-30-7-9)25-26-18(27)16-12(23)2-1-5-24-16/h1-5,9,13H,6-8H2/t9-,13-/m1/s1 |
| InChIKey | MJGHBRHROSBHHY-NOZJJQNGSA-N |
| XLogP | 3.52 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|