C7H11NO3 — CID 90415558
6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 90415558) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 90415558 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)N1CC2CC(O)C1C2 |
| InChI | InChI=1S/C7H11NO3/c9-6-2-4-1-5(6)8(3-4)7(10)11/h4-6,9H,1-3H2,(H,10,11) |
| InChIKey | JVRYNXFVLYZTAF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |