C7H10N2O4 — CID 68887875
(1R)-2,5-diazabicyclo[2.2.1]heptane-2,6-dicarboxylic acid (PubChem CID 68887875) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is (1R)-2,5-diazabicyclo[2.2.1]heptane-2,6-dicarboxylic acid.
| Compound Name | (1R)-2,5-diazabicyclo[2.2.1]heptane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 68887875 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | (1R)-2,5-diazabicyclo[2.2.1]heptane-2,6-dicarboxylic acid |
| SMILES | O=C(O)C1NC2C[C@H]1N(C(=O)O)C2 |
| InChI | InChI=1S/C7H10N2O4/c10-6(11)5-4-1-3(8-5)2-9(4)7(12)13/h3-5,8H,1-2H2,(H,10,11)(H,12,13)/t3?,4-,5?/m1/s1 |
| InChIKey | AMGZCKXSCSECFQ-ACHVEOLNSA-N |
| XLogP | -0.84 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |